C21H30N3O4S+ — CID 7615008
ethyl 2-[2-(3-methoxyphenyl)imino-3-(3-morpholin-4-ium-4-ylpropyl)-1,3-thiazol-4-yl]acetate (PubChem CID 7615008) has the molecular formula C21H30N3O4S+ and a molecular weight of 420.56 g/mol. Its IUPAC name is ethyl 2-[2-(3-methoxyphenyl)imino-3-(3-morpholin-4-ium-4-ylpropyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(3-methoxyphenyl)imino-3-(3-morpholin-4-ium-4-ylpropyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 7615008 |
| Molecular Formula | C21H30N3O4S+ |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | ethyl 2-[2-(3-methoxyphenyl)imino-3-(3-morpholin-4-ium-4-ylpropyl)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1cs/c(=N\c2cccc(OC)c2)n1CCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C21H29N3O4S/c1-3-28-20(25)15-18-16-29-21(22-17-6-4-7-19(14-17)26-2)24(18)9-5-8-23-10-12-27-13-11-23/h4,6-7,14,16H,3,5,8-13,15H2,1-2H3/p+1/b22-21- |
| InChIKey | UAKMTOMSDQCYPW-DQRAZIAOSA-O |
| XLogP | 1.20 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|