C20H26ClN3O3S — CID 7303173
ethyl 2-[2-(4-chlorophenyl)imino-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-4-yl]acetate (PubChem CID 7303173) has the molecular formula C20H26ClN3O3S and a molecular weight of 423.97 g/mol. Its IUPAC name is ethyl 2-[2-(4-chlorophenyl)imino-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(4-chlorophenyl)imino-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 7303173 |
| Molecular Formula | C20H26ClN3O3S |
| Molecular Weight | 423.97 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | ethyl 2-[2-(4-chlorophenyl)imino-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1cs/c(=N\c2ccc(Cl)cc2)n1CCCN1CCOCC1 |
| InChI | InChI=1S/C20H26ClN3O3S/c1-2-27-19(25)14-18-15-28-20(22-17-6-4-16(21)5-7-17)24(18)9-3-8-23-10-12-26-13-11-23/h4-7,15H,2-3,8-14H2,1H3/b22-20- |
| InChIKey | LMSFYPCEZDHGKC-XDOYNYLZSA-N |
| XLogP | 3.26 |
| TPSA | 56.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.97 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|