C17H21Cl2N3OS — CID 7615054
N-(2,6-dichlorophenyl)-4-methyl-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-imine (PubChem CID 7615054) has the molecular formula C17H21Cl2N3OS and a molecular weight of 386.35 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-4-methyl-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-imine.
| Compound Name | N-(2,6-dichlorophenyl)-4-methyl-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 7615054 |
| Molecular Formula | C17H21Cl2N3OS |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | N-(2,6-dichlorophenyl)-4-methyl-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-imine |
| SMILES | Cc1cs/c(=N\c2c(Cl)cccc2Cl)n1CCCN1CCOCC1 |
| InChI | InChI=1S/C17H21Cl2N3OS/c1-13-12-24-17(20-16-14(18)4-2-5-15(16)19)22(13)7-3-6-21-8-10-23-11-9-21/h2,4-5,12H,3,6-11H2,1H3/b20-17- |
| InChIKey | XMCBWKBKFZCDFY-JZJYNLBNSA-N |
| XLogP | 4.12 |
| TPSA | 29.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|