About N-(2,6-dichlorophenyl)-4-methyl-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-imine
N-(2,6-dichlorophenyl)-4-methyl-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-imine (PubChem CID 7615054) has the molecular formula C17H21Cl2N3OS
and a molecular weight of 386.35 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-4-methyl-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-imine.
Molecular Properties
| Compound Name | N-(2,6-dichlorophenyl)-4-methyl-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-imine |
| PubChem CID | 7615054 |
| Molecular Formula | C17H21Cl2N3OS |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | N-(2,6-dichlorophenyl)-4-methyl-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-imine |
| SMILES | Cc1cs/c(=N\c2c(Cl)cccc2Cl)n1CCCN1CCOCC1 |
| InChI | InChI=1S/C17H21Cl2N3OS/c1-13-12-24-17(20-16-14(18)4-2-5-15(16)19)22(13)7-3-6-21-8-10-23-11-9-21/h2,4-5,12H,3,6-11H2,1H3/b20-17- |
| InChIKey | XMCBWKBKFZCDFY-JZJYNLBNSA-N |
| XLogP | 4.12 |
| TPSA | 29.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|
Analyze N-(2,6-dichlorophenyl)-4-methyl-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dichlorophenyl)-4-methyl-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-imine?
The IUPAC name of N-(2,6-dichlorophenyl)-4-methyl-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-imine (CID 7615054) is N-(2,6-dichlorophenyl)-4-methyl-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-imine.
What is the SMILES notation for N-(2,6-dichlorophenyl)-4-methyl-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-imine?
The canonical SMILES for N-(2,6-dichlorophenyl)-4-methyl-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-imine is Cc1cs/c(=N\c2c(Cl)cccc2Cl)n1CCCN1CCOCC1.
What is the InChIKey of N-(2,6-dichlorophenyl)-4-methyl-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-imine?
The InChIKey is XMCBWKBKFZCDFY-JZJYNLBNSA-N. The full InChI is InChI=1S/C17H21Cl2N3OS/c1-13-12-24-17(20-16-14(18)4-2-5-15(16)19)22(13)7-3-6-21-8-10-23-11-9-21/h2,4-5,12H,3,6-11H2,1H3/b20-17-.
What are the key properties of N-(2,6-dichlorophenyl)-4-methyl-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-imine?
N-(2,6-dichlorophenyl)-4-methyl-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-imine has a molecular weight of 386.35 g/mol, XLogP of 4.12, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dichlorophenyl)-4-methyl-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-imine is sourced from PubChem (CID 7615054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).