C15H18N2O3S — CID 45148706
ethyl 2-[3-(2-hydroxyethyl)-2-phenylimino-1,3-thiazol-4-yl]acetate (PubChem CID 45148706) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is ethyl 2-[3-(2-hydroxyethyl)-2-phenylimino-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[3-(2-hydroxyethyl)-2-phenylimino-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 45148706 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | ethyl 2-[3-(2-hydroxyethyl)-2-phenylimino-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1cs/c(=N\c2ccccc2)n1CCO |
| InChI | InChI=1S/C15H18N2O3S/c1-2-20-14(19)10-13-11-21-15(17(13)8-9-18)16-12-6-4-3-5-7-12/h3-7,11,18H,2,8-10H2,1H3/b16-15- |
| InChIKey | RDUGELKMUALVGS-NXVVXOECSA-N |
| XLogP | 1.88 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|