C21H22N2O2S — CID 4993132
ethyl 2-[4-(4-ethylphenyl)-2-phenylimino-1,3-thiazol-3-yl]acetate (PubChem CID 4993132) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is ethyl 2-[4-(4-ethylphenyl)-2-phenylimino-1,3-thiazol-3-yl]acetate.
| Compound Name | ethyl 2-[4-(4-ethylphenyl)-2-phenylimino-1,3-thiazol-3-yl]acetate |
|---|---|
| PubChem CID | 4993132 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | ethyl 2-[4-(4-ethylphenyl)-2-phenylimino-1,3-thiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1c(-c2ccc(CC)cc2)cs/c1=N\c1ccccc1 |
| InChI | InChI=1S/C21H22N2O2S/c1-3-16-10-12-17(13-11-16)19-15-26-21(22-18-8-6-5-7-9-18)23(19)14-20(24)25-4-2/h5-13,15H,3-4,14H2,1-2H3/b22-21- |
| InChIKey | UBCCYZRXZOFIGV-DQRAZIAOSA-N |
| XLogP | 4.57 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|