C22H26N2S — CID 18813168
3-hexyl-N-(4-methylphenyl)-4-phenyl-1,3-thiazol-2-imine (PubChem CID 18813168) has the molecular formula C22H26N2S and a molecular weight of 350.53 g/mol. Its IUPAC name is 3-hexyl-N-(4-methylphenyl)-4-phenyl-1,3-thiazol-2-imine.
| Compound Name | 3-hexyl-N-(4-methylphenyl)-4-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 18813168 |
| Molecular Formula | C22H26N2S |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 3-hexyl-N-(4-methylphenyl)-4-phenyl-1,3-thiazol-2-imine |
| SMILES | CCCCCCn1c(-c2ccccc2)cs/c1=N\c1ccc(C)cc1 |
| InChI | InChI=1S/C22H26N2S/c1-3-4-5-9-16-24-21(19-10-7-6-8-11-19)17-25-22(24)23-20-14-12-18(2)13-15-20/h6-8,10-15,17H,3-5,9,16H2,1-2H3/b23-22- |
| InChIKey | HUHYJZHMYDEMQC-FCQUAONHSA-N |
| XLogP | 6.34 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|