C15H19NS2 — CID 118667967
3-hexyl-4-phenyl-1,3-thiazole-2-thione (PubChem CID 118667967) has the molecular formula C15H19NS2 and a molecular weight of 277.46 g/mol. Its IUPAC name is 3-hexyl-4-phenyl-1,3-thiazole-2-thione.
| Compound Name | 3-hexyl-4-phenyl-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 118667967 |
| Molecular Formula | C15H19NS2 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 3-hexyl-4-phenyl-1,3-thiazole-2-thione |
| SMILES | CCCCCCn1c(-c2ccccc2)csc1=S |
| InChI | InChI=1S/C15H19NS2/c1-2-3-4-8-11-16-14(12-18-15(16)17)13-9-6-5-7-10-13/h5-7,9-10,12H,2-4,8,11H2,1H3 |
| InChIKey | MTMNWNKYUJVLLA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|