C27H22BrN3O4S — CID 90484860
ethyl 2-[4-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2-phenylimino-1,3-thiazol-3-yl]acetate;hydrobromide (PubChem CID 90484860) has the molecular formula C27H22BrN3O4S and a molecular weight of 564.46 g/mol. Its IUPAC name is ethyl 2-[4-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2-phenylimino-1,3-thiazol-3-yl]acetate;hydrobromide.
| Compound Name | ethyl 2-[4-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2-phenylimino-1,3-thiazol-3-yl]acetate;hydrobromide |
|---|---|
| PubChem CID | 90484860 |
| Molecular Formula | C27H22BrN3O4S |
| Molecular Weight | 564.46 g/mol |
| Exact Mass | 563.05 |
| IUPAC Name | ethyl 2-[4-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2-phenylimino-1,3-thiazol-3-yl]acetate;hydrobromide |
| SMILES | Br.CCOC(=O)Cn1c(-c2cccc(N3C(=O)c4ccccc4C3=O)c2)cs/c1=N\c1ccccc1 |
| InChI | InChI=1S/C27H21N3O4S.BrH/c1-2-34-24(31)16-29-23(17-35-27(29)28-19-10-4-3-5-11-19)18-9-8-12-20(15-18)30-25(32)21-13-6-7-14-22(21)26(30)33;/h3-15,17H,2,16H2,1H3;1H/b28-27-; |
| InChIKey | WFHGCKPJUWLKJS-LXCLTORNSA-N |
| XLogP | 5.39 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.46 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|