C33H29N3O3S — CID 4602472
2-[3-[3-(6-hydroxyhexyl)-2-naphthalen-1-ylimino-1,3-thiazol-4-yl]phenyl]isoindole-1,3-dione (PubChem CID 4602472) has the molecular formula C33H29N3O3S and a molecular weight of 547.68 g/mol. Its IUPAC name is 2-[3-[3-(6-hydroxyhexyl)-2-naphthalen-1-ylimino-1,3-thiazol-4-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[3-(6-hydroxyhexyl)-2-naphthalen-1-ylimino-1,3-thiazol-4-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 4602472 |
| Molecular Formula | C33H29N3O3S |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | 2-[3-[3-(6-hydroxyhexyl)-2-naphthalen-1-ylimino-1,3-thiazol-4-yl]phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1cccc(-c2cs/c(=N/c3cccc4ccccc34)n2CCCCCCO)c1 |
| InChI | InChI=1S/C33H29N3O3S/c37-20-8-2-1-7-19-35-30(22-40-33(35)34-29-18-10-12-23-11-3-4-15-26(23)29)24-13-9-14-25(21-24)36-31(38)27-16-5-6-17-28(27)32(36)39/h3-6,9-18,21-22,37H,1-2,7-8,19-20H2/b34-33+ |
| InChIKey | BVFJLENJXXCSEE-JEIPZWNWSA-N |
| XLogP | 6.96 |
| TPSA | 74.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|