C27H18BrN3O2S — CID 126478088
2-[3-[2-(naphthalen-1-ylamino)-1,3-thiazol-4-yl]phenyl]isoindole-1,3-dione;hydrobromide (PubChem CID 126478088) has the molecular formula C27H18BrN3O2S and a molecular weight of 528.43 g/mol. Its IUPAC name is 2-[3-[2-(naphthalen-1-ylamino)-1,3-thiazol-4-yl]phenyl]isoindole-1,3-dione;hydrobromide.
| Compound Name | 2-[3-[2-(naphthalen-1-ylamino)-1,3-thiazol-4-yl]phenyl]isoindole-1,3-dione;hydrobromide |
|---|---|
| PubChem CID | 126478088 |
| Molecular Formula | C27H18BrN3O2S |
| Molecular Weight | 528.43 g/mol |
| Exact Mass | 527.03 |
| IUPAC Name | 2-[3-[2-(naphthalen-1-ylamino)-1,3-thiazol-4-yl]phenyl]isoindole-1,3-dione;hydrobromide |
| SMILES | Br.O=C1c2ccccc2C(=O)N1c1cccc(-c2csc(Nc3cccc4ccccc34)n2)c1 |
| InChI | InChI=1S/C27H17N3O2S.BrH/c31-25-21-12-3-4-13-22(21)26(32)30(25)19-10-5-9-18(15-19)24-16-33-27(29-24)28-23-14-6-8-17-7-1-2-11-20(17)23;/h1-16H,(H,28,29);1H |
| InChIKey | CYOYKJWLRPDXTG-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.43 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|