C22H20N4S — CID 10150381
N-isoquinolin-5-yl-4-(4-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-amine (PubChem CID 10150381) has the molecular formula C22H20N4S and a molecular weight of 372.50 g/mol. Its IUPAC name is N-isoquinolin-5-yl-4-(4-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-isoquinolin-5-yl-4-(4-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 10150381 |
| Molecular Formula | C22H20N4S |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | N-isoquinolin-5-yl-4-(4-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-amine |
| SMILES | c1cc(Nc2nc(-c3ccc(N4CCCC4)cc3)cs2)c2ccncc2c1 |
| InChI | InChI=1S/C22H20N4S/c1-2-13-26(12-1)18-8-6-16(7-9-18)21-15-27-22(25-21)24-20-5-3-4-17-14-23-11-10-19(17)20/h3-11,14-15H,1-2,12-13H2,(H,24,25) |
| InChIKey | PFVAIVJYWPNONO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |