C21H23N3S — CID 58910960
N-(2-phenylethyl)-4-(4-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-amine (PubChem CID 58910960) has the molecular formula C21H23N3S and a molecular weight of 349.50 g/mol. Its IUPAC name is N-(2-phenylethyl)-4-(4-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-(2-phenylethyl)-4-(4-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58910960 |
| Molecular Formula | C21H23N3S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | N-(2-phenylethyl)-4-(4-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-amine |
| SMILES | c1ccc(CCNc2nc(-c3ccc(N4CCCC4)cc3)cs2)cc1 |
| InChI | InChI=1S/C21H23N3S/c1-2-6-17(7-3-1)12-13-22-21-23-20(16-25-21)18-8-10-19(11-9-18)24-14-4-5-15-24/h1-3,6-11,16H,4-5,12-15H2,(H,22,23) |
| InChIKey | NPOSQMZFYNFOHZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |