C17H14Cl2N2S — CID 2470553
4-(2,4-dichlorophenyl)-N-(2-phenylethyl)-1,3-thiazol-2-amine (PubChem CID 2470553) has the molecular formula C17H14Cl2N2S and a molecular weight of 349.29 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-(2-phenylethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dichlorophenyl)-N-(2-phenylethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2470553 |
| Molecular Formula | C17H14Cl2N2S |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-(2-phenylethyl)-1,3-thiazol-2-amine |
| SMILES | Clc1ccc(-c2csc(NCCc3ccccc3)n2)c(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2N2S/c18-13-6-7-14(15(19)10-13)16-11-22-17(21-16)20-9-8-12-4-2-1-3-5-12/h1-7,10-11H,8-9H2,(H,20,21) |
| InChIKey | ZRVRTYXSNQHFKC-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |