C11H5Cl5N2OS — CID 4674763
2,2,2-trichloro-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 4674763) has the molecular formula C11H5Cl5N2OS and a molecular weight of 390.51 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 4674763 |
| Molecular Formula | C11H5Cl5N2OS |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 387.86 |
| IUPAC Name | 2,2,2-trichloro-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(Nc1nc(-c2ccc(Cl)cc2Cl)cs1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H5Cl5N2OS/c12-5-1-2-6(7(13)3-5)8-4-20-10(17-8)18-9(19)11(14,15)16/h1-4H,(H,17,18,19) |
| InChIKey | NJDMYBXVTHCVJH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|