C14H12Cl2N2O2S — CID 903662
(2S)-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]oxolane-2-carboxamide (PubChem CID 903662) has the molecular formula C14H12Cl2N2O2S and a molecular weight of 343.24 g/mol. Its IUPAC name is (2S)-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 903662 |
| Molecular Formula | C14H12Cl2N2O2S |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | (2S)-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]oxolane-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccc(Cl)cc2Cl)cs1)[C@@H]1CCCO1 |
| InChI | InChI=1S/C14H12Cl2N2O2S/c15-8-3-4-9(10(16)6-8)11-7-21-14(17-11)18-13(19)12-2-1-5-20-12/h3-4,6-7,12H,1-2,5H2,(H,17,18,19)/t12-/m0/s1 |
| InChIKey | LYLIYECAEZMBJK-LBPRGKRZSA-N |
| XLogP | 4.23 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |