C14H13FN2O2S — CID 868890
(2R)-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]oxolane-2-carboxamide (PubChem CID 868890) has the molecular formula C14H13FN2O2S and a molecular weight of 292.33 g/mol. Its IUPAC name is (2R)-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]oxolane-2-carboxamide.
| Compound Name | (2R)-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 868890 |
| Molecular Formula | C14H13FN2O2S |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | (2R)-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]oxolane-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccc(F)cc2)cs1)[C@H]1CCCO1 |
| InChI | InChI=1S/C14H13FN2O2S/c15-10-5-3-9(4-6-10)11-8-20-14(16-11)17-13(18)12-2-1-7-19-12/h3-6,8,12H,1-2,7H2,(H,16,17,18)/t12-/m1/s1 |
| InChIKey | FRCMNKWDESUUSZ-GFCCVEGCSA-N |
| XLogP | 3.07 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |