C15H14N2O4S — CID 41364782
(2S)-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]oxolane-2-carboxamide (PubChem CID 41364782) has the molecular formula C15H14N2O4S and a molecular weight of 318.35 g/mol. Its IUPAC name is (2S)-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 41364782 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | (2S)-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]oxolane-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccc3c(c2)OCO3)cs1)[C@@H]1CCCO1 |
| InChI | InChI=1S/C15H14N2O4S/c18-14(12-2-1-5-19-12)17-15-16-10(7-22-15)9-3-4-11-13(6-9)21-8-20-11/h3-4,6-7,12H,1-2,5,8H2,(H,16,17,18)/t12-/m0/s1 |
| InChIKey | JHHUKTJXIUGFSP-LBPRGKRZSA-N |
| XLogP | 2.66 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |