C16H16N2O4S — CID 51189301
N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]oxane-4-carboxamide (PubChem CID 51189301) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]oxane-4-carboxamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 51189301 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]oxane-4-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccc3c(c2)OCO3)cs1)C1CCOCC1 |
| InChI | InChI=1S/C16H16N2O4S/c19-15(10-3-5-20-6-4-10)18-16-17-12(8-23-16)11-1-2-13-14(7-11)22-9-21-13/h1-2,7-8,10H,3-6,9H2,(H,17,18,19) |
| InChIKey | QCPWCLJZUYAXKT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |