C27H27N5OS — CID 134385028
4-[2-(2-pyridin-3-ylethylamino)-1,3-thiazol-4-yl]-N-(4-pyrrolidin-1-ylphenyl)benzamide (PubChem CID 134385028) has the molecular formula C27H27N5OS and a molecular weight of 469.61 g/mol. Its IUPAC name is 4-[2-(2-pyridin-3-ylethylamino)-1,3-thiazol-4-yl]-N-(4-pyrrolidin-1-ylphenyl)benzamide.
| Compound Name | 4-[2-(2-pyridin-3-ylethylamino)-1,3-thiazol-4-yl]-N-(4-pyrrolidin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 134385028 |
| Molecular Formula | C27H27N5OS |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 4-[2-(2-pyridin-3-ylethylamino)-1,3-thiazol-4-yl]-N-(4-pyrrolidin-1-ylphenyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)cc1)c1ccc(-c2csc(NCCc3cccnc3)n2)cc1 |
| InChI | InChI=1S/C27H27N5OS/c33-26(30-23-9-11-24(12-10-23)32-16-1-2-17-32)22-7-5-21(6-8-22)25-19-34-27(31-25)29-15-13-20-4-3-14-28-18-20/h3-12,14,18-19H,1-2,13,15-17H2,(H,29,31)(H,30,33) |
| InChIKey | URGGXPMZOFTKDG-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|