C23H23N3S — CID 134126798
4-[4-(diethylamino)phenyl]-N-naphthalen-1-yl-1,3-thiazol-2-amine (PubChem CID 134126798) has the molecular formula C23H23N3S and a molecular weight of 373.53 g/mol. Its IUPAC name is 4-[4-(diethylamino)phenyl]-N-naphthalen-1-yl-1,3-thiazol-2-amine.
| Compound Name | 4-[4-(diethylamino)phenyl]-N-naphthalen-1-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 134126798 |
| Molecular Formula | C23H23N3S |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 4-[4-(diethylamino)phenyl]-N-naphthalen-1-yl-1,3-thiazol-2-amine |
| SMILES | CCN(CC)c1ccc(-c2csc(Nc3cccc4ccccc34)n2)cc1 |
| InChI | InChI=1S/C23H23N3S/c1-3-26(4-2)19-14-12-18(13-15-19)22-16-27-23(25-22)24-21-11-7-9-17-8-5-6-10-20(17)21/h5-16H,3-4H2,1-2H3,(H,24,25) |
| InChIKey | MZJFTNIXRYLGPD-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |