C29H30N5S+ — CID 58910537
4-N,4-N-diethyl-2-methyl-1-N-[4-[4-(3-phenylimidazol-1-ium-1-yl)phenyl]-1,3-thiazol-2-yl]benzene-1,4-diamine (PubChem CID 58910537) has the molecular formula C29H30N5S+ and a molecular weight of 480.66 g/mol. Its IUPAC name is 4-N,4-N-diethyl-2-methyl-1-N-[4-[4-(3-phenylimidazol-1-ium-1-yl)phenyl]-1,3-thiazol-2-yl]benzene-1,4-diamine.
| Compound Name | 4-N,4-N-diethyl-2-methyl-1-N-[4-[4-(3-phenylimidazol-1-ium-1-yl)phenyl]-1,3-thiazol-2-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 58910537 |
| Molecular Formula | C29H30N5S+ |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 4-N,4-N-diethyl-2-methyl-1-N-[4-[4-(3-phenylimidazol-1-ium-1-yl)phenyl]-1,3-thiazol-2-yl]benzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(Nc2nc(-c3ccc(-[n+]4ccn(-c5ccccc5)c4)cc3)cs2)c(C)c1 |
| InChI | InChI=1S/C29H30N5S/c1-4-32(5-2)26-15-16-27(22(3)19-26)30-29-31-28(20-35-29)23-11-13-25(14-12-23)34-18-17-33(21-34)24-9-7-6-8-10-24/h6-21H,4-5H2,1-3H3,(H,30,31)/q+1 |
| InChIKey | QSJWXVYOAJLNSC-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|