C21H18N2S — CID 2132345
N-(2,4-dimethylphenyl)-4-naphthalen-2-yl-1,3-thiazol-2-amine (PubChem CID 2132345) has the molecular formula C21H18N2S and a molecular weight of 330.46 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-4-naphthalen-2-yl-1,3-thiazol-2-amine.
| Compound Name | N-(2,4-dimethylphenyl)-4-naphthalen-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2132345 |
| Molecular Formula | C21H18N2S |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-(2,4-dimethylphenyl)-4-naphthalen-2-yl-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(Nc2nc(-c3ccc4ccccc4c3)cs2)c(C)c1 |
| InChI | InChI=1S/C21H18N2S/c1-14-7-10-19(15(2)11-14)22-21-23-20(13-24-21)18-9-8-16-5-3-4-6-17(16)12-18/h3-13H,1-2H3,(H,22,23) |
| InChIKey | KJNOSWRUSJVZIK-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |