C16H13ClN2OS — CID 972909
4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-3-methylphenol (PubChem CID 972909) has the molecular formula C16H13ClN2OS and a molecular weight of 316.81 g/mol. Its IUPAC name is 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-3-methylphenol.
| Compound Name | 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-3-methylphenol |
|---|---|
| PubChem CID | 972909 |
| Molecular Formula | C16H13ClN2OS |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-3-methylphenol |
| SMILES | Cc1cc(O)ccc1Nc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C16H13ClN2OS/c1-10-8-13(20)6-7-14(10)18-16-19-15(9-21-16)11-2-4-12(17)5-3-11/h2-9,20H,1H3,(H,18,19) |
| InChIKey | SVTPBBDCXLMZHJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|