C14H12N2OS2 — CID 2215270
3-methyl-4-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]phenol (PubChem CID 2215270) has the molecular formula C14H12N2OS2 and a molecular weight of 288.40 g/mol. Its IUPAC name is 3-methyl-4-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]phenol.
| Compound Name | 3-methyl-4-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]phenol |
|---|---|
| PubChem CID | 2215270 |
| Molecular Formula | C14H12N2OS2 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 3-methyl-4-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]phenol |
| SMILES | Cc1cc(O)ccc1Nc1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C14H12N2OS2/c1-9-7-10(17)4-5-11(9)15-14-16-12(8-19-14)13-3-2-6-18-13/h2-8,17H,1H3,(H,15,16) |
| InChIKey | GADVRFSWDPZFDZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|