C14H10N2O3S2 — CID 972612
2-hydroxy-4-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]benzoic acid (PubChem CID 972612) has the molecular formula C14H10N2O3S2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-hydroxy-4-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]benzoic acid.
| Compound Name | 2-hydroxy-4-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 972612 |
| Molecular Formula | C14H10N2O3S2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 2-hydroxy-4-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2nc(-c3cccs3)cs2)cc1O |
| InChI | InChI=1S/C14H10N2O3S2/c17-11-6-8(3-4-9(11)13(18)19)15-14-16-10(7-21-14)12-2-1-5-20-12/h1-7,17H,(H,15,16)(H,18,19) |
| InChIKey | XELJZBKGWKBZBK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |