C14H8Cl2N2OS2 — CID 4200224
2,5-dichloro-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 4200224) has the molecular formula C14H8Cl2N2OS2 and a molecular weight of 355.27 g/mol. Its IUPAC name is 2,5-dichloro-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 2,5-dichloro-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 4200224 |
| Molecular Formula | C14H8Cl2N2OS2 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 353.95 |
| IUPAC Name | 2,5-dichloro-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nc(-c2cccs2)cs1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H8Cl2N2OS2/c15-8-3-4-10(16)9(6-8)13(19)18-14-17-11(7-21-14)12-2-1-5-20-12/h1-7H,(H,17,18,19) |
| InChIKey | UYPDQAUKTNIGAY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |