C13H8Cl2N2S2 — CID 854639
N-(2,5-dichlorophenyl)-4-thiophen-2-yl-1,3-thiazol-2-amine (PubChem CID 854639) has the molecular formula C13H8Cl2N2S2 and a molecular weight of 327.26 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-4-thiophen-2-yl-1,3-thiazol-2-amine.
| Compound Name | N-(2,5-dichlorophenyl)-4-thiophen-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 854639 |
| Molecular Formula | C13H8Cl2N2S2 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 325.95 |
| IUPAC Name | N-(2,5-dichlorophenyl)-4-thiophen-2-yl-1,3-thiazol-2-amine |
| SMILES | Clc1ccc(Cl)c(Nc2nc(-c3cccs3)cs2)c1 |
| InChI | InChI=1S/C13H8Cl2N2S2/c14-8-3-4-9(15)10(6-8)16-13-17-11(7-19-13)12-2-1-5-18-12/h1-7H,(H,16,17) |
| InChIKey | GCMHZKYUYHPJLP-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |