2-[2-(2,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid

C11H8Cl2N2O2S — CID 75176643

IUPAC2-[2-(2,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid
SMILESO=C(O)Cc1csc(Nc2cc(Cl)ccc2Cl)n1
InChIInChI=1S/C11H8Cl2N2O2S/c12-6-1-2-8(13)9(3-6)15-11-14-7(5-18-11)4-10(16)17/h1-3,5H,4H2,(H,14,15)(H,16,17)
InChIKeyXKMQWSCEOOTUFS-UHFFFAOYSA-N
MW303.17 g/mol
LogP3.82
Rot. Bonds4

About 2-[2-(2,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid

2-[2-(2,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 75176643) has the molecular formula C11H8Cl2N2O2S and a molecular weight of 303.17 g/mol. Its IUPAC name is 2-[2-(2,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(2,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid
PubChem CID75176643
Molecular FormulaC11H8Cl2N2O2S
Molecular Weight303.17 g/mol
Exact Mass301.97
IUPAC Name2-[2-(2,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid
SMILESO=C(O)Cc1csc(Nc2cc(Cl)ccc2Cl)n1
InChIInChI=1S/C11H8Cl2N2O2S/c12-6-1-2-8(13)9(3-6)15-11-14-7(5-18-11)4-10(16)17/h1-3,5H,4H2,(H,14,15)(H,16,17)
InChIKeyXKMQWSCEOOTUFS-UHFFFAOYSA-N
XLogP3.82
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.17
LogP ≤ 53.82
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[2-(2,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[2-(2,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid (CID 75176643) is 2-[2-(2,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(2,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-(2,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid is O=C(O)Cc1csc(Nc2cc(Cl)ccc2Cl)n1.
What is the InChIKey of 2-[2-(2,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid?
The InChIKey is XKMQWSCEOOTUFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8Cl2N2O2S/c12-6-1-2-8(13)9(3-6)15-11-14-7(5-18-11)4-10(16)17/h1-3,5H,4H2,(H,14,15)(H,16,17).
What are the key properties of 2-[2-(2,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid?
2-[2-(2,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid has a molecular weight of 303.17 g/mol, XLogP of 3.82, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 75176643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).