C12H10ClN2O3S- — CID 9154786
2-[2-(5-chloro-2-methoxyanilino)-1,3-thiazol-4-yl]acetate (PubChem CID 9154786) has the molecular formula C12H10ClN2O3S- and a molecular weight of 297.74 g/mol. Its IUPAC name is 2-[2-(5-chloro-2-methoxyanilino)-1,3-thiazol-4-yl]acetate.
| Compound Name | 2-[2-(5-chloro-2-methoxyanilino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 9154786 |
| Molecular Formula | C12H10ClN2O3S- |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 2-[2-(5-chloro-2-methoxyanilino)-1,3-thiazol-4-yl]acetate |
| SMILES | COc1ccc(Cl)cc1Nc1nc(CC(=O)[O-])cs1 |
| InChI | InChI=1S/C12H11ClN2O3S/c1-18-10-3-2-7(13)4-9(10)15-12-14-8(6-19-12)5-11(16)17/h2-4,6H,5H2,1H3,(H,14,15)(H,16,17)/p-1 |
| InChIKey | FUQDECOHZQPGMO-UHFFFAOYSA-M |
| XLogP | 1.84 |
| TPSA | 74.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |