C11H7Cl2N2O2S- — CID 9154802
2-[2-(3,5-dichloroanilino)-1,3-thiazol-4-yl]acetate (PubChem CID 9154802) has the molecular formula C11H7Cl2N2O2S- and a molecular weight of 302.16 g/mol. Its IUPAC name is 2-[2-(3,5-dichloroanilino)-1,3-thiazol-4-yl]acetate.
| Compound Name | 2-[2-(3,5-dichloroanilino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 9154802 |
| Molecular Formula | C11H7Cl2N2O2S- |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 300.96 |
| IUPAC Name | 2-[2-(3,5-dichloroanilino)-1,3-thiazol-4-yl]acetate |
| SMILES | O=C([O-])Cc1csc(Nc2cc(Cl)cc(Cl)c2)n1 |
| InChI | InChI=1S/C11H8Cl2N2O2S/c12-6-1-7(13)3-8(2-6)14-11-15-9(5-18-11)4-10(16)17/h1-3,5H,4H2,(H,14,15)(H,16,17)/p-1 |
| InChIKey | NCOJLVAZZSOBPA-UHFFFAOYSA-M |
| XLogP | 2.49 |
| TPSA | 65.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |