C13H10Cl3N2O3S- — CID 9155901
2-[2-[2-(2,4,6-trichlorophenoxy)ethylamino]-1,3-thiazol-4-yl]acetate (PubChem CID 9155901) has the molecular formula C13H10Cl3N2O3S- and a molecular weight of 380.66 g/mol. Its IUPAC name is 2-[2-[2-(2,4,6-trichlorophenoxy)ethylamino]-1,3-thiazol-4-yl]acetate.
| Compound Name | 2-[2-[2-(2,4,6-trichlorophenoxy)ethylamino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 9155901 |
| Molecular Formula | C13H10Cl3N2O3S- |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 378.95 |
| IUPAC Name | 2-[2-[2-(2,4,6-trichlorophenoxy)ethylamino]-1,3-thiazol-4-yl]acetate |
| SMILES | O=C([O-])Cc1csc(NCCOc2c(Cl)cc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C13H11Cl3N2O3S/c14-7-3-9(15)12(10(16)4-7)21-2-1-17-13-18-8(6-22-13)5-11(19)20/h3-4,6H,1-2,5H2,(H,17,18)(H,19,20)/p-1 |
| InChIKey | GJTYUNKKUVTHOP-UHFFFAOYSA-M |
| XLogP | 2.89 |
| TPSA | 74.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|