C16H17Cl2N3O3S — CID 110532323
methyl 2-[2-[(2Z)-2-[(3,5-dichloro-4-propoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 110532323) has the molecular formula C16H17Cl2N3O3S and a molecular weight of 402.30 g/mol. Its IUPAC name is methyl 2-[2-[(2Z)-2-[(3,5-dichloro-4-propoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[2-[(2Z)-2-[(3,5-dichloro-4-propoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 110532323 |
| Molecular Formula | C16H17Cl2N3O3S |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | methyl 2-[2-[(2Z)-2-[(3,5-dichloro-4-propoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCCOc1c(Cl)cc(/C=N\Nc2nc(CC(=O)OC)cs2)cc1Cl |
| InChI | InChI=1S/C16H17Cl2N3O3S/c1-3-4-24-15-12(17)5-10(6-13(15)18)8-19-21-16-20-11(9-25-16)7-14(22)23-2/h5-6,8-9H,3-4,7H2,1-2H3,(H,20,21)/b19-8- |
| InChIKey | NLWDOVKVBXSVLC-UWVJOHFNSA-N |
| XLogP | 4.40 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|