C18H22N4O6S — CID 110531178
ethyl 2-[2-[(2Z)-2-[(3-methoxy-5-nitro-4-propoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 110531178) has the molecular formula C18H22N4O6S and a molecular weight of 422.46 g/mol. Its IUPAC name is ethyl 2-[2-[(2Z)-2-[(3-methoxy-5-nitro-4-propoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[(2Z)-2-[(3-methoxy-5-nitro-4-propoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 110531178 |
| Molecular Formula | C18H22N4O6S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | ethyl 2-[2-[(2Z)-2-[(3-methoxy-5-nitro-4-propoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCCOc1c(OC)cc(/C=N\Nc2nc(CC(=O)OCC)cs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22N4O6S/c1-4-6-28-17-14(22(24)25)7-12(8-15(17)26-3)10-19-21-18-20-13(11-29-18)9-16(23)27-5-2/h7-8,10-11H,4-6,9H2,1-3H3,(H,20,21)/b19-10- |
| InChIKey | SKFHDKUTHOUADN-GRSHGNNSSA-N |
| XLogP | 3.40 |
| TPSA | 125.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|