C14H13BrN4O5S — CID 168624045
ethyl 2-[2-[2-[(3-bromo-4-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168624045) has the molecular formula C14H13BrN4O5S and a molecular weight of 429.25 g/mol. Its IUPAC name is ethyl 2-[2-[2-[(3-bromo-4-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[(3-bromo-4-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168624045 |
| Molecular Formula | C14H13BrN4O5S |
| Molecular Weight | 429.25 g/mol |
| Exact Mass | 427.98 |
| IUPAC Name | ethyl 2-[2-[2-[(3-bromo-4-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2cc(Br)c(O)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C14H13BrN4O5S/c1-2-24-12(20)5-9-7-25-14(17-9)18-16-6-8-3-10(15)13(21)11(4-8)19(22)23/h3-4,6-7,21H,2,5H2,1H3,(H,17,18) |
| InChIKey | XVGUBWNHUJMJKM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.25 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|