C20H17FN4O4S2 — CID 168625190
ethyl 2-[2-[2-[[4-(4-fluorophenyl)sulfanyl-3-nitrophenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168625190) has the molecular formula C20H17FN4O4S2 and a molecular weight of 460.51 g/mol. Its IUPAC name is ethyl 2-[2-[2-[[4-(4-fluorophenyl)sulfanyl-3-nitrophenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[[4-(4-fluorophenyl)sulfanyl-3-nitrophenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168625190 |
| Molecular Formula | C20H17FN4O4S2 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | ethyl 2-[2-[2-[[4-(4-fluorophenyl)sulfanyl-3-nitrophenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2ccc(Sc3ccc(F)cc3)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C20H17FN4O4S2/c1-2-29-19(26)10-15-12-30-20(23-15)24-22-11-13-3-8-18(17(9-13)25(27)28)31-16-6-4-14(21)5-7-16/h3-9,11-12H,2,10H2,1H3,(H,23,24) |
| InChIKey | SUVFWPOFWYZQQK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|