C18H20IN3O6S — CID 168624693
ethyl 2-[2-[2-[[3-iodo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168624693) has the molecular formula C18H20IN3O6S and a molecular weight of 533.34 g/mol. Its IUPAC name is ethyl 2-[2-[2-[[3-iodo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[[3-iodo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168624693 |
| Molecular Formula | C18H20IN3O6S |
| Molecular Weight | 533.34 g/mol |
| Exact Mass | 533.01 |
| IUPAC Name | ethyl 2-[2-[2-[[3-iodo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2cc(I)c(OCC(=O)OC)c(OC)c2)n1 |
| InChI | InChI=1S/C18H20IN3O6S/c1-4-27-15(23)7-12-10-29-18(21-12)22-20-8-11-5-13(19)17(14(6-11)25-2)28-9-16(24)26-3/h5-6,8,10H,4,7,9H2,1-3H3,(H,21,22) |
| InChIKey | PLDAMLWYTPHTRD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 108.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|