C22H24N4O5S — CID 110529774
N-[(Z)-(3-ethoxy-5-nitro-4-propoxyphenyl)methylideneamino]-4-(2-methoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 110529774) has the molecular formula C22H24N4O5S and a molecular weight of 456.52 g/mol. Its IUPAC name is N-[(Z)-(3-ethoxy-5-nitro-4-propoxyphenyl)methylideneamino]-4-(2-methoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(Z)-(3-ethoxy-5-nitro-4-propoxyphenyl)methylideneamino]-4-(2-methoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 110529774 |
| Molecular Formula | C22H24N4O5S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | N-[(Z)-(3-ethoxy-5-nitro-4-propoxyphenyl)methylideneamino]-4-(2-methoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | CCCOc1c(OCC)cc(/C=N\Nc2nc(-c3ccccc3OC)cs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H24N4O5S/c1-4-10-31-21-18(26(27)28)11-15(12-20(21)30-5-2)13-23-25-22-24-17(14-32-22)16-8-6-7-9-19(16)29-3/h6-9,11-14H,4-5,10H2,1-3H3,(H,24,25)/b23-13- |
| InChIKey | FRVPDQDGUHKGCH-QRVIBDJDSA-N |
| XLogP | 5.36 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|