C18H18N4O4S — CID 110510799
N-[(Z)-(3,4-diethoxy-5-nitrophenyl)methylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 110510799) has the molecular formula C18H18N4O4S and a molecular weight of 386.43 g/mol. Its IUPAC name is N-[(Z)-(3,4-diethoxy-5-nitrophenyl)methylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(Z)-(3,4-diethoxy-5-nitrophenyl)methylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 110510799 |
| Molecular Formula | C18H18N4O4S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | N-[(Z)-(3,4-diethoxy-5-nitrophenyl)methylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | CCOc1cc(/C=N\Nc2nc3ccccc3s2)cc([N+](=O)[O-])c1OCC |
| InChI | InChI=1S/C18H18N4O4S/c1-3-25-15-10-12(9-14(22(23)24)17(15)26-4-2)11-19-21-18-20-13-7-5-6-8-16(13)27-18/h5-11H,3-4H2,1-2H3,(H,20,21)/b19-11- |
| InChIKey | CNQIFIFEAKCYAK-ODLFYWEKSA-N |
| XLogP | 4.45 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|