C16H14BrN3OS — CID 110510813
N-[(Z)-(3-bromo-4-ethoxyphenyl)methylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 110510813) has the molecular formula C16H14BrN3OS and a molecular weight of 376.28 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-4-ethoxyphenyl)methylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(Z)-(3-bromo-4-ethoxyphenyl)methylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 110510813 |
| Molecular Formula | C16H14BrN3OS |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | N-[(Z)-(3-bromo-4-ethoxyphenyl)methylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | CCOc1ccc(/C=N\Nc2nc3ccccc3s2)cc1Br |
| InChI | InChI=1S/C16H14BrN3OS/c1-2-21-14-8-7-11(9-12(14)17)10-18-20-16-19-13-5-3-4-6-15(13)22-16/h3-10H,2H2,1H3,(H,19,20)/b18-10- |
| InChIKey | DXXSRQKDSCPWJI-ZDLGFXPLSA-N |
| XLogP | 4.90 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|