C24H31N3O2S — CID 110510761
N-[(Z)-(3-methoxy-4-nonoxyphenyl)methylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 110510761) has the molecular formula C24H31N3O2S and a molecular weight of 425.60 g/mol. Its IUPAC name is N-[(Z)-(3-methoxy-4-nonoxyphenyl)methylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(Z)-(3-methoxy-4-nonoxyphenyl)methylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 110510761 |
| Molecular Formula | C24H31N3O2S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N-[(Z)-(3-methoxy-4-nonoxyphenyl)methylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | CCCCCCCCCOc1ccc(/C=N\Nc2nc3ccccc3s2)cc1OC |
| InChI | InChI=1S/C24H31N3O2S/c1-3-4-5-6-7-8-11-16-29-21-15-14-19(17-22(21)28-2)18-25-27-24-26-20-12-9-10-13-23(20)30-24/h9-10,12-15,17-18H,3-8,11,16H2,1-2H3,(H,26,27)/b25-18- |
| InChIKey | JDWVNWUQLYRYIT-BWAHOGKJSA-N |
| XLogP | 6.88 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|