C27H28N4O2S — CID 6307723
N-[(E)-(3-methoxy-4-pentoxyphenyl)methylideneamino]-N'-phenyl-1,3-benzothiazole-2-carboximidamide (PubChem CID 6307723) has the molecular formula C27H28N4O2S and a molecular weight of 472.61 g/mol. Its IUPAC name is N-[(E)-(3-methoxy-4-pentoxyphenyl)methylideneamino]-N'-phenyl-1,3-benzothiazole-2-carboximidamide.
| Compound Name | N-[(E)-(3-methoxy-4-pentoxyphenyl)methylideneamino]-N'-phenyl-1,3-benzothiazole-2-carboximidamide |
|---|---|
| PubChem CID | 6307723 |
| Molecular Formula | C27H28N4O2S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | N-[(E)-(3-methoxy-4-pentoxyphenyl)methylideneamino]-N'-phenyl-1,3-benzothiazole-2-carboximidamide |
| SMILES | CCCCCOc1ccc(/C=N/N/C(=N\c2ccccc2)c2nc3ccccc3s2)cc1OC |
| InChI | InChI=1S/C27H28N4O2S/c1-3-4-10-17-33-23-16-15-20(18-24(23)32-2)19-28-31-26(29-21-11-6-5-7-12-21)27-30-22-13-8-9-14-25(22)34-27/h5-9,11-16,18-19H,3-4,10,17H2,1-2H3,(H,29,31)/b28-19+ |
| InChIKey | HQBQTHODEJGPGP-TURZUDJPSA-N |
| XLogP | 6.58 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|