C28H30N4O2S — CID 6276625
N-[(E)-(3-methoxy-4-pentoxyphenyl)methylideneamino]-N'-(4-methylphenyl)-1,3-benzothiazole-2-carboximidamide (PubChem CID 6276625) has the molecular formula C28H30N4O2S and a molecular weight of 486.64 g/mol. Its IUPAC name is N-[(E)-(3-methoxy-4-pentoxyphenyl)methylideneamino]-N'-(4-methylphenyl)-1,3-benzothiazole-2-carboximidamide.
| Compound Name | N-[(E)-(3-methoxy-4-pentoxyphenyl)methylideneamino]-N'-(4-methylphenyl)-1,3-benzothiazole-2-carboximidamide |
|---|---|
| PubChem CID | 6276625 |
| Molecular Formula | C28H30N4O2S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | N-[(E)-(3-methoxy-4-pentoxyphenyl)methylideneamino]-N'-(4-methylphenyl)-1,3-benzothiazole-2-carboximidamide |
| SMILES | CCCCCOc1ccc(/C=N/N/C(=N\c2ccc(C)cc2)c2nc3ccccc3s2)cc1OC |
| InChI | InChI=1S/C28H30N4O2S/c1-4-5-8-17-34-24-16-13-21(18-25(24)33-3)19-29-32-27(30-22-14-11-20(2)12-15-22)28-31-23-9-6-7-10-26(23)35-28/h6-7,9-16,18-19H,4-5,8,17H2,1-3H3,(H,30,32)/b29-19+ |
| InChIKey | QASVUAJTJWYYGN-VUTHCHCSSA-N |
| XLogP | 6.88 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|