C27H28N4OS — CID 19260414
N-[(E)-[4-(3-methylbutoxy)phenyl]methylideneamino]-N'-(4-methylphenyl)-1,3-benzothiazole-2-carboximidamide (PubChem CID 19260414) has the molecular formula C27H28N4OS and a molecular weight of 456.62 g/mol. Its IUPAC name is N-[(E)-[4-(3-methylbutoxy)phenyl]methylideneamino]-N'-(4-methylphenyl)-1,3-benzothiazole-2-carboximidamide.
| Compound Name | N-[(E)-[4-(3-methylbutoxy)phenyl]methylideneamino]-N'-(4-methylphenyl)-1,3-benzothiazole-2-carboximidamide |
|---|---|
| PubChem CID | 19260414 |
| Molecular Formula | C27H28N4OS |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | N-[(E)-[4-(3-methylbutoxy)phenyl]methylideneamino]-N'-(4-methylphenyl)-1,3-benzothiazole-2-carboximidamide |
| SMILES | Cc1ccc(/N=C(\N/N=C/c2ccc(OCCC(C)C)cc2)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C27H28N4OS/c1-19(2)16-17-32-23-14-10-21(11-15-23)18-28-31-26(29-22-12-8-20(3)9-13-22)27-30-24-6-4-5-7-25(24)33-27/h4-15,18-19H,16-17H2,1-3H3,(H,29,31)/b28-18+ |
| InChIKey | BOZRTSVXFKMNIQ-MTDXEUNCSA-N |
| XLogP | 6.73 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|