C26H20N4OS — CID 135602490
N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-N'-(4-methylphenyl)-1,3-benzothiazole-2-carboximidamide (PubChem CID 135602490) has the molecular formula C26H20N4OS and a molecular weight of 436.54 g/mol. Its IUPAC name is N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-N'-(4-methylphenyl)-1,3-benzothiazole-2-carboximidamide.
| Compound Name | N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-N'-(4-methylphenyl)-1,3-benzothiazole-2-carboximidamide |
|---|---|
| PubChem CID | 135602490 |
| Molecular Formula | C26H20N4OS |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-N'-(4-methylphenyl)-1,3-benzothiazole-2-carboximidamide |
| SMILES | Cc1ccc(/N=C(/N/N=C/c2c(O)ccc3ccccc23)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C26H20N4OS/c1-17-10-13-19(14-11-17)28-25(26-29-22-8-4-5-9-24(22)32-26)30-27-16-21-20-7-3-2-6-18(20)12-15-23(21)31/h2-16,31H,1H3,(H,28,30)/b27-16+ |
| InChIKey | QJDTVBPFRKOORW-JVWAILMASA-N |
| XLogP | 6.17 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|