C22H17N5O3S — CID 135602491
N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]-N'-(4-methylphenyl)-1,3-benzothiazole-2-carboximidamide (PubChem CID 135602491) has the molecular formula C22H17N5O3S and a molecular weight of 431.48 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]-N'-(4-methylphenyl)-1,3-benzothiazole-2-carboximidamide.
| Compound Name | N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]-N'-(4-methylphenyl)-1,3-benzothiazole-2-carboximidamide |
|---|---|
| PubChem CID | 135602491 |
| Molecular Formula | C22H17N5O3S |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]-N'-(4-methylphenyl)-1,3-benzothiazole-2-carboximidamide |
| SMILES | Cc1ccc(/N=C(\N/N=C/c2cc([N+](=O)[O-])ccc2O)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C22H17N5O3S/c1-14-6-8-16(9-7-14)24-21(22-25-18-4-2-3-5-20(18)31-22)26-23-13-15-12-17(27(29)30)10-11-19(15)28/h2-13,28H,1H3,(H,24,26)/b23-13+ |
| InChIKey | CTJSASLYIYFJOT-YDZHTSKRSA-N |
| XLogP | 4.92 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|