C23H17N5O3 — CID 135785158
N-[(Z)-(2-hydroxy-5-nitrophenyl)methylideneamino]-N'-phenylquinoline-2-carboximidamide (PubChem CID 135785158) has the molecular formula C23H17N5O3 and a molecular weight of 411.42 g/mol. Its IUPAC name is N-[(Z)-(2-hydroxy-5-nitrophenyl)methylideneamino]-N'-phenylquinoline-2-carboximidamide.
| Compound Name | N-[(Z)-(2-hydroxy-5-nitrophenyl)methylideneamino]-N'-phenylquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 135785158 |
| Molecular Formula | C23H17N5O3 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | N-[(Z)-(2-hydroxy-5-nitrophenyl)methylideneamino]-N'-phenylquinoline-2-carboximidamide |
| SMILES | O=[N+]([O-])c1ccc(O)c(/C=N\N/C(=N/c2ccccc2)c2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C23H17N5O3/c29-22-13-11-19(28(30)31)14-17(22)15-24-27-23(25-18-7-2-1-3-8-18)21-12-10-16-6-4-5-9-20(16)26-21/h1-15,29H,(H,25,27)/b24-15- |
| InChIKey | DNYWFIFVRROKQR-IWIPYMOSSA-N |
| XLogP | 4.55 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|