C23H16BrN5O3 — CID 5120502
N-[(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-N'-phenylquinoline-2-carboximidamide (PubChem CID 5120502) has the molecular formula C23H16BrN5O3 and a molecular weight of 490.32 g/mol. Its IUPAC name is N-[(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-N'-phenylquinoline-2-carboximidamide.
| Compound Name | N-[(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-N'-phenylquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 5120502 |
| Molecular Formula | C23H16BrN5O3 |
| Molecular Weight | 490.32 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | N-[(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-N'-phenylquinoline-2-carboximidamide |
| SMILES | O=[N+]([O-])c1cc(Br)c(O)c(C=NN/C(=N\c2ccccc2)c2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C23H16BrN5O3/c24-19-13-18(29(31)32)12-16(22(19)30)14-25-28-23(26-17-7-2-1-3-8-17)21-11-10-15-6-4-5-9-20(15)27-21/h1-14,30H,(H,26,28) |
| InChIKey | CWFHPJUCFUDEHL-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.32 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|