C28H31BrN4O4 — CID 5229987
N-[(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-3,5-ditert-butyl-4-hydroxy-N'-phenylbenzenecarboximidamide (PubChem CID 5229987) has the molecular formula C28H31BrN4O4 and a molecular weight of 567.48 g/mol. Its IUPAC name is N-[(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-3,5-ditert-butyl-4-hydroxy-N'-phenylbenzenecarboximidamide.
| Compound Name | N-[(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-3,5-ditert-butyl-4-hydroxy-N'-phenylbenzenecarboximidamide |
|---|---|
| PubChem CID | 5229987 |
| Molecular Formula | C28H31BrN4O4 |
| Molecular Weight | 567.48 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | N-[(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-3,5-ditert-butyl-4-hydroxy-N'-phenylbenzenecarboximidamide |
| SMILES | CC(C)(C)c1cc(/C(=N/c2ccccc2)NN=Cc2cc([N+](=O)[O-])cc(Br)c2O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C28H31BrN4O4/c1-27(2,3)21-13-17(14-22(25(21)35)28(4,5)6)26(31-19-10-8-7-9-11-19)32-30-16-18-12-20(33(36)37)15-23(29)24(18)34/h7-16,34-35H,1-6H3,(H,31,32) |
| InChIKey | MWBKYGPPUZIFRX-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 120.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.48 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|