C24H16Br3N5O3 — CID 135602601
N-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-N'-(2,6-dibromo-4-methylphenyl)quinoline-2-carboximidamide (PubChem CID 135602601) has the molecular formula C24H16Br3N5O3 and a molecular weight of 662.14 g/mol. Its IUPAC name is N-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-N'-(2,6-dibromo-4-methylphenyl)quinoline-2-carboximidamide.
| Compound Name | N-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-N'-(2,6-dibromo-4-methylphenyl)quinoline-2-carboximidamide |
|---|---|
| PubChem CID | 135602601 |
| Molecular Formula | C24H16Br3N5O3 |
| Molecular Weight | 662.14 g/mol |
| Exact Mass | 658.88 |
| IUPAC Name | N-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-N'-(2,6-dibromo-4-methylphenyl)quinoline-2-carboximidamide |
| SMILES | Cc1cc(Br)c(/N=C(\N/N=C/c2cc([N+](=O)[O-])cc(Br)c2O)c2ccc3ccccc3n2)c(Br)c1 |
| InChI | InChI=1S/C24H16Br3N5O3/c1-13-8-17(25)22(18(26)9-13)30-24(21-7-6-14-4-2-3-5-20(14)29-21)31-28-12-15-10-16(32(34)35)11-19(27)23(15)33/h2-12,33H,1H3,(H,30,31)/b28-12+ |
| InChIKey | QPCBNYAOWKNYSQ-KVSWJAHQSA-N |
| XLogP | 7.15 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.14 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|