C25H20Br2N4O — CID 4659168
N'-(2,6-dibromo-4-methylphenyl)-N-[(4-methoxyphenyl)methylideneamino]quinoline-2-carboximidamide (PubChem CID 4659168) has the molecular formula C25H20Br2N4O and a molecular weight of 552.27 g/mol. Its IUPAC name is N'-(2,6-dibromo-4-methylphenyl)-N-[(4-methoxyphenyl)methylideneamino]quinoline-2-carboximidamide.
| Compound Name | N'-(2,6-dibromo-4-methylphenyl)-N-[(4-methoxyphenyl)methylideneamino]quinoline-2-carboximidamide |
|---|---|
| PubChem CID | 4659168 |
| Molecular Formula | C25H20Br2N4O |
| Molecular Weight | 552.27 g/mol |
| Exact Mass | 550.00 |
| IUPAC Name | N'-(2,6-dibromo-4-methylphenyl)-N-[(4-methoxyphenyl)methylideneamino]quinoline-2-carboximidamide |
| SMILES | COc1ccc(C=NN/C(=N\c2c(Br)cc(C)cc2Br)c2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C25H20Br2N4O/c1-16-13-20(26)24(21(27)14-16)30-25(23-12-9-18-5-3-4-6-22(18)29-23)31-28-15-17-7-10-19(32-2)11-8-17/h3-15H,1-2H3,(H,30,31) |
| InChIKey | MLCUGACJMVZBPJ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.27 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|